70161-44-3
| Name | Sodium hydroxymethylglycinate |
| CAS | 70161-44-3 |
| EINECS(EC#) | 274-357-8 |
| Molecular Formula | C3H6NNaO3 |
| MDL Number | MFCD04307769 |
| Molecular Weight | 127.07 |
| MOL File | 70161-44-3.mol |
Chemical Properties
| density | 1.653[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Colorless to light yellow |
| Stability: | Stability Incompatible with strong oxidizing agents. |
| Water Solubility | 500g/L at 20℃ |
| Cosmetics Ingredients Functions | PRESERVATIVE HAIR CONDITIONING |
| InChI | InChI=1S/C3H7NO3.Na.H/c5-2-4-1-3(6)7;;/h4-5H,1-2H2,(H,6,7);; |
| InChIKey | QIOBDSHYFNLTBH-UHFFFAOYSA-N |
| SMILES | C(NCO)C(=O)O.[NaH] |
| LogP | -1.533 at 26℃ |
| Uses | |
| CAS DataBase Reference | 70161-44-3 |
| EPA Substance Registry System | Glycine, N-(hydroxymethyl)-, monosodium salt(70161-44-3) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 |