
68890-66-4
| Name | Piroctone olamine |
| CAS | 68890-66-4 |
| EINECS(EC#) | 272-574-2 |
| Molecular Formula | C16H30N2O3 |
| MDL Number | MFCD01690792 |
| Molecular Weight | 298.42 |
| MOL File | 68890-66-4.mol |
Chemical Properties
| Melting point | 134.0 to 138.0 °C |
| Boiling point | 135-235℃[at 101 325 Pa] |
| density | 1.1[at 20℃] |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly, Sonicated), Methanol (Slightly) |
| form | neat |
| pka | 5.9-7.4[at 20 ℃] |
| color | White to Off-White |
| Water Solubility | 400-50000mg/L at 20-25℃ |
| Merck | 14,7502 |
| Major Application | agriculture environmental |
| Cosmetics Ingredients Functions | PRESERVATIVE ANTI-SEBORRHEIC |
| InChI | InChI=1S/C14H23NO2.C2H7NO/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;3-1-2-4/h6,8,11,17H,7,9H2,1-5H3;4H,1-3H2 |
| InChIKey | BTSZTGGZJQFALU-UHFFFAOYSA-N |
| SMILES | C(N)CO.C(C1=CC(C)=CC(=O)N1O)C(C)CC(C)(C)C |
| LogP | 1.05-3.86 at 20-25℃ |
| CAS DataBase Reference | 68890-66-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318-H412 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| WGK Germany | 2 |
| RTECS | UU7786150 |
| REACH Registrations | Active |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Skin Irrit. 2 |

;