
635-22-3
| Name | 4-Chloro-3-nitroaniline |
| CAS | 635-22-3 |
| EINECS(EC#) | 211-231-3 |
| Molecular Formula | C6H5ClN2O2 |
| MDL Number | MFCD00007844 |
| Molecular Weight | 172.57 |
| MOL File | 635-22-3.mol |
Chemical Properties
| Appearance | ochre powder |
| Melting point | 99-101 °C (lit.) |
| Boiling point | 200°C (rough estimate) |
| density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.87±0.10(Predicted) |
| color | White to Yellow to Orange |
| BRN | 1309394 |
| InChI | InChI=1S/C6H5ClN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| InChIKey | FOHHWGVAOVDVLP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C([N+]([O-])=O)=C1 |
| Uses | |
| CAS DataBase Reference | 635-22-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-chloro-3-nitro-(635-22-3) |
| EPA Substance Registry System | 635-22-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS06,GHS08,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H315-H319-H300-H310-H330-H373-H411 |
| Precautionary statements | P301+P310a-P304+P340-P320-P330-P501a-P260-P264-P273-P280-P284-P302+P350-P262-P270-P271-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P305+P351+P338+P337+P313-P314-P391-P403+P233-P405-P501 |
| Hazard Codes | T+,N,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX1750000 |
| Hazard Note | Very Toxic |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 STOT RE 2 |
| Safety Profile | |
| Hazardous Substances Data | 635-22-3(Hazardous Substances Data) |



