6332-56-5
| Name | 3-Nitro-2-pyridinol |
| CAS | 6332-56-5 |
| EINECS(EC#) | 228-709-2 |
| Molecular Formula | C5H4N2O3 |
| MDL Number | MFCD00006270 |
| Molecular Weight | 140.1 |
| MOL File | 6332-56-5.mol |
Chemical Properties
| Appearance | yellow to yellow-brown cryst. powder or needles |
| Melting point | 212 °C (dec.) (lit.) |
| Boiling point | 256.56°C (rough estimate) |
| density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.37±0.10(Predicted) |
| color | yellow |
| Detection Methods | HPLC |
| BRN | 124474 |
| InChI | InChI=1S/C5H4N2O3/c8-5-4(7(9)10)2-1-3-6-5/h1-3H,(H,6,8) |
| InChIKey | BOAFCICMVMFLIT-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 6332-56-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxy-3-nitropyridine(6332-56-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | UU7718000 |
| F | 10 |
| REACH Registrations | Active |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |