
15128-90-2
| Name | 3-HYDROXY-6-METHYL-2-NITROPYRIDINE |
| CAS | 15128-90-2 |
| EINECS(EC#) | 239-192-8 |
| Molecular Formula | C6H6N2O3 |
| MDL Number | MFCD00006259 |
| Molecular Weight | 154.12 |
| MOL File | 15128-90-2.mol |
Chemical Properties
| Appearance | yellow fine crystalline powder |
| Melting point | 106-107 °C (lit.) |
| Boiling point | 277.46°C (rough estimate) |
| density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.01±0.22(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 974751 |
| InChI | InChI=1S/C6H6N2O3/c1-4-2-3-5(9)6(7-4)8(10)11/h2-3,9H,1H3 |
| InChIKey | WZMGQHIBXUAYGS-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC(C)=CC=C1O |
| CAS DataBase Reference | 15128-90-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
