39745-39-6
| Name | 6-Hydroxy-5-nitro-2-picoline |
| CAS | 39745-39-6 |
| Molecular Formula | C6H6N2O3 |
| MDL Number | MFCD03001414 |
| Molecular Weight | 154.12 |
| MOL File | 39745-39-6.mol |
Chemical Properties
| Appearance | Yellow crystalline powder |
| Melting point | 225-226 C |
| Boiling point | 277.46°C (rough estimate) |
| density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.47±0.10(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | 1S/C6H6N2O3/c1-4-2-3-5(8(10)11)6(9)7-4/h2-3H,1H3,(H,7,9) |
| InChIKey | YVYDGIGILRUPED-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(O)n1)[N+]([O-])=O |
| CAS DataBase Reference | 39745-39-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
