
632-69-9
| Name | Acid Red 94 |
| CAS | 632-69-9 |
| EINECS(EC#) | 211-182-8 |
| Molecular Formula | C20H2Cl4I4Na2O5 |
| MDL Number | MFCD00151169 |
| Molecular Weight | 1017.64 |
| MOL File | 632-69-9.mol |
Chemical Properties
| Appearance | red-brown to brown powder |
| Melting point | >300°C |
| storage temp. | Store at +15°C to +30°C. |
| solubility | H2O: soluble1mg/mL |
| Colour Index | 45440 |
| form | Solid |
| pka | 3.9, 4.7(at 25℃) |
| color | Red-brown |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| ε(extinction coefficient) | ≥90000 at 546-550nm at 0.008g/L |
| λmax | 548 nm |
| Merck | 14,8262 |
| BRN | 3645857 |
| Biological Applications | Apoptosis assay; diagnosis of diseases related to amyloid accumulation; controlling plant diseases; identifying fungi; treating skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory system |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C20H4Cl4I4O5.2Na/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 |
| InChIKey | UWBXIFCTIZXXLS-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]C(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C2=C3C=C(I)C(=O)C(I)=C3Oc4c(I)c([O-])c(I)cc24 |
