619-19-2
| Name | 4-Nitrosalicylic acid |
| CAS | 619-19-2 |
| EINECS(EC#) | 210-584-0 |
| Molecular Formula | C7H5NO5 |
| MDL Number | MFCD00071505 |
| Molecular Weight | 183.12 |
| MOL File | 619-19-2.mol |
Chemical Properties
| Appearance | White to yellow crystalline powder |
| Melting point | 235-239 °C (lit.) |
| Boiling point | 316.77°C (rough estimate) |
| density | 1.6074 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid or Crystalline Powder |
| pka | 2.11±0.13(Predicted) |
| color | White to pale brown |
| InChI | InChI=1S/C7H5NO5/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1O |
| CAS DataBase Reference | 619-19-2(CAS DataBase Reference) |
| EPA Substance Registry System | 619-19-2(EPA Substance) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VO5300100 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |