
5907-38-0
| Name | Analgin |
| CAS | 5907-38-0 |
| EINECS(EC#) | 611-790-7 |
| Molecular Formula | C13H18N3NaO5S |
| MDL Number | MFCD00150293 |
| Molecular Weight | 351.35 |
| MOL File | 5907-38-0.mol |
Chemical Properties
| Appearance | White or almost white, crystalline powder |
| Melting point | 221℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble25mg/mL, clear |
| form | powder |
| color | white to beige |
| BRN | 3865381 |
| Major Application | clinical forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C13H17N3O4S.Na.H2O/c1-10-12(14(2)9-21(18,19)20)13(17)16(15(10)3)11-7-5-4-6-8-11;;/h4-8H,9H2,1-3H3,(H,18,19,20);;1H2/q;+1;/p-1 |
| InChIKey | UNZIDPIPYUMVPA-UHFFFAOYSA-M |
| SMILES | O.[Na+].CN(CS([O-])(=O)=O)C1=C(C)N(C)N(C1=O)c2ccccc2 |
| CAS DataBase Reference | 5907-38-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | PB1320000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
