55289-36-6
| Name | 3-Bromo-2-methylaniline |
| CAS | 55289-36-6 |
| EINECS(EC#) | 259-568-5 |
| Molecular Formula | C7H8BrN |
| MDL Number | MFCD00051579 |
| Molecular Weight | 186.05 |
| MOL File | 55289-36-6.mol |
Chemical Properties
| Boiling point | 248 °C (lit.) |
| density | 1.51 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 3.38±0.10(Predicted) |
| color | Clear colorless to yellow to pale brown |
| Sensitive | Light Sensitive |
| BRN | 2354213 |
| InChI | InChI=1S/C7H8BrN/c1-5-6(8)3-2-4-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | IILVSKMKMOJHMA-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(Br)=C1C |
| CAS DataBase Reference | 55289-36-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Bromo-2-methylaniline(55289-36-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P312+P362+P364-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
