5355-16-8
| Name | Diaveridine |
| CAS | 5355-16-8 |
| EINECS(EC#) | 226-333-3 |
| Molecular Formula | C13H16N4O2 |
| MDL Number | MFCD00057349 |
| Molecular Weight | 260.29 |
| MOL File | 5355-16-8.mol |
Chemical Properties
| Melting point | 233° |
| Boiling point | 506.1±60.0 °C(Predicted) |
| density | 1.252±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly) |
| form | neat |
| pka | 7.11±0.10(Predicted) |
| color | White to Pale Yellow |
| Merck | 13,3017 |
| BRN | 258464 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H16N4O2/c1-18-10-4-3-8(6-11(10)19-2)5-9-7-16-13(15)17-12(9)14/h3-4,6-7H,5H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | LDBTVAXGKYIFHO-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(CC2=CC=C(OC)C(OC)=C2)C(N)=N1 |
| CAS DataBase Reference | 5355-16-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | UV8142000 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |