53222-92-7
| Name | 3-Amino-2-methylphenol |
| CAS | 53222-92-7 |
| EINECS(EC#) | 258-438-5 |
| Molecular Formula | C7H9NO |
| MDL Number | MFCD00007787 |
| Molecular Weight | 123.15 |
| MOL File | 53222-92-7.mol |
Chemical Properties
| Appearance | brown to black crystalline powder |
| Melting point | 129-130 °C(lit.) |
| Boiling point | 229.26°C (rough estimate) |
| density | 1.0877 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 10.36±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H9NO/c1-5-6(8)3-2-4-7(5)9/h2-4,9H,8H2,1H3 |
| InChIKey | FLROJJGKUKLCAE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(N)=C1C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
