
5460-31-1
| Name | 2-Methyl-3-nitrophenol |
| CAS | 5460-31-1 |
| EINECS(EC#) | 226-739-0 |
| Molecular Formula | C7H7NO3 |
| MDL Number | MFCD00007241 |
| Molecular Weight | 153.14 |
| MOL File | 5460-31-1.mol |
Chemical Properties
| Appearance | Yellow to brown crystalline powder |
| Melting point | 146-148 °C (lit.) |
| Boiling point | 147.0-152.0°C |
| density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL |
| form | powder to crystal |
| pka | 9.11±0.25(Predicted) |
| color | Light yellow to Brown to Dark green |
| BRN | 1946057 |
| InChI | InChI=1S/C7H7NO3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3 |
| InChIKey | GAKLFAZBKQGUBO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 5460-31-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitro-o-cresol(5460-31-1) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2446 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
