455-24-3
| Name | 4-(Trifluoromethyl)benzoic acid |
| CAS | 455-24-3 |
| EINECS(EC#) | 207-242-8 |
| Molecular Formula | C8H5F3O2 |
| MDL Number | MFCD00002562 |
| Molecular Weight | 190.12 |
| MOL File | 455-24-3.mol |
Chemical Properties
| Appearance | White to light yellow crystal powde |
| Melting point | 219-220 °C(lit.) |
| Boiling point | 247°C 753mm |
| density | 1.3173 (estimate) |
| Fp | 247°C/753mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Fine Crystalline Powder |
| pka | 3.69±0.10(Predicted) |
| color | White to slight gray |
| Water Solubility | Soluble in water. |
| Detection Methods | GC,NMR |
| BRN | 2049241 |
| InChI | InChI=1S/C8H5F3O2/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h1-4H,(H,12,13) |
| InChIKey | SWKPKONEIZGROQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 455-24-3(CAS DataBase Reference) |
| NIST Chemistry Reference | «ALPHA»,«alpha»,«alpha»-trifluoro-p-toluic acid(455-24-3) |
| EPA Substance Registry System | 455-24-3(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |