4408-64-4
| Name | N-Methyliminodiacetic acid |
| CAS | 4408-64-4 |
| EINECS(EC#) | 224-557-6 |
| Molecular Formula | C5H9NO4 |
| MDL Number | MFCD00004284 |
| Molecular Weight | 147.13 |
| MOL File | 4408-64-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 220 °C (dec.)(lit.) |
| Boiling point | 267.21°C (rough estimate) |
| density | 1.4285 (rough estimate) |
| refractive index | 1.4210 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly, Heated, Sonicated), Water (Soluble) |
| form | Powder |
| pka | pK1:2.15;pK2:10.09 (25°C) |
| color | White to cream |
| Water Solubility | Soluble in water. Slightly soluble in dimethyl sulfoxide. |
| BRN | 1765449 |
| InChI | InChI=1S/C5H9NO4/c1-6(2-4(7)8)3-5(9)10/h2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XWSGEVNYFYKXCP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)C |
| LogP | -0.910 (est) |
| CAS DataBase Reference | 4408-64-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29171900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |