403-45-2
| Name | 6-Fluoronicotinic acid |
| CAS | 403-45-2 |
| EINECS(EC#) | 251-228-4 |
| Molecular Formula | C6H4FNO2 |
| MDL Number | MFCD01859863 |
| Molecular Weight | 141.1 |
| MOL File | 403-45-2.mol |
Chemical Properties
| Melting point | 144-148 °C(lit.) |
| Boiling point | 309.4±22.0 °C(Predicted) |
| density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.41±0.10(Predicted) |
| color | White to Orange to Green |
| Detection Methods | HPLC |
| InChI | InChI=1S/C6H4FNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10) |
| InChIKey | UJDLCTNVHJEBDG-UHFFFAOYSA-N |
| SMILES | C1=NC(F)=CC=C1C(O)=O |
| CAS DataBase Reference | 403-45-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |