
82671-06-5
| Name | 2,6-Dichloro-5-fluoronicotinic acid |
| CAS | 82671-06-5 |
| EINECS(EC#) | 628-094-4 |
| Molecular Formula | C6H2Cl2FNO2 |
| MDL Number | MFCD00799517 |
| Molecular Weight | 209.99 |
| MOL File | 82671-06-5.mol |
Chemical Properties
| Appearance | light yellow to beige fine crystalline powder |
| Melting point | 152-155 °C (lit.) |
| Boiling point | 247°C (rough estimate) |
| density | 1.6207 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.38±0.32(Predicted) |
| color | White to Yellow to Orange |
| Detection Methods | HPLC |
| BRN | 4311035 |
| InChI | InChI=1S/C6H2Cl2FNO2/c7-4-2(6(11)12)1-3(9)5(8)10-4/h1H,(H,11,12) |
| InChIKey | LTDGKGCHRNNCAC-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C(F)C=C1C(O)=O |
| CAS DataBase Reference | 82671-06-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
