38707-70-9
| Name | 8-Quinolinecarbaldehyde |
| CAS | 38707-70-9 |
| Molecular Formula | C10H7NO |
| MDL Number | MFCD06227440 |
| Molecular Weight | 157.17 |
| MOL File | 38707-70-9.mol |
Chemical Properties
| Melting point | 95-96°C |
| Boiling point | 314.3±15.0 °C(Predicted) |
| density | 1.223±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.45±0.17(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC |
| BRN | 113039 |
| InChI | InChI=1S/C10H7NO/c12-7-9-4-1-3-8-5-2-6-11-10(8)9/h1-7H |
| InChIKey | OVZQVGZERAFSPI-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2C=O)C=CC=1 |
| CAS DataBase Reference | 38707-70-9(CAS DataBase Reference) |
| Storage Precautions | Air sensitive |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
