38235-77-7
| Name | (R)-(+)-N-Benzyl-1-phenylethylamine |
| CAS | 38235-77-7 |
| EINECS(EC#) | 609-537-0 |
| Molecular Formula | C15H17N |
| MDL Number | MFCD00015010 |
| Molecular Weight | 211.3 |
| MOL File | 38235-77-7.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Melting point | 111-114°C |
| alpha | 39 º (neat) |
| Boiling point | 171 °C15 mm Hg(lit.) |
| density | 1.01 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.79±0.19(Predicted) |
| color | Clear Colourless to Pale yellow |
| Specific Gravity | 1.01 |
| Optical Rotation | [α]20/D +38°, neat |
| Sensitive | Air Sensitive |
| BRN | 3589990 |
| InChI | 1S/C15H17N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-/m1/s1 |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@@H](NCc1ccccc1)c2ccccc2 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2735 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |