37622-90-5
| Name | Ethyl pyrazole-4-carboxylate |
| CAS | 37622-90-5 |
| EINECS(EC#) | 609-452-9 |
| Molecular Formula | C6H8N2O2 |
| MDL Number | MFCD00010844 |
| Molecular Weight | 140.14 |
| MOL File | 37622-90-5.mol |
Chemical Properties
| Appearance | White to pale yellow crystalline powder |
| Melting point | 78-80 °C (lit.) |
| Boiling point | 138-140 °C/3 mmHg (lit.) |
| density | 1.2850 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| Fp | 138-140°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Miscible with acetone. |
| form | Crystalline Powder |
| pka | 11.70±0.50(Predicted) |
| color | White to pale yellow |
| InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-3-7-8-4-5/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | KACZQOKEFKFNDB-UHFFFAOYSA-N |
| SMILES | N1C=C(C(OCC)=O)C=N1 |
| LogP | 0.909 (est) |
| CAS DataBase Reference | 37622-90-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(C2H5COO)-pyrazole(37622-90-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
