35094-87-2
| Name | 2,4,5-TRIHYDROXYBENZALDEHYDE |
| CAS | 35094-87-2 |
| Molecular Formula | C7H6O4 |
| MDL Number | MFCD00016592 |
| Molecular Weight | 154.12 |
| MOL File | 35094-87-2.mol |
Chemical Properties
| Appearance | yellow to brown or khaki crystalline powder |
| Melting point | 223-225 °C (lit.) |
| Boiling point | 237.46°C (rough estimate) |
| density | 1.3725 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 7.41±0.23(Predicted) |
| color | Yellow to brown or khaki |
| Sensitive | Air Sensitive |
| BRN | 2250084 |
| InChI | InChI=1S/C7H6O4/c8-3-4-1-6(10)7(11)2-5(4)9/h1-3,9-11H |
| InChIKey | WNCNWLVQSHZVKV-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=C(O)C=C1O |
| CAS DataBase Reference | 35094-87-2(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |