349-95-1
| Name | 4-(Trifluoromethyl)benzyl alcohol |
| CAS | 349-95-1 |
| EINECS(EC#) | 206-494-6 |
| Molecular Formula | C8H7F3O |
| MDL Number | MFCD00004661 |
| Molecular Weight | 176.14 |
| MOL File | 349-95-1.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Melting point | 22-25 °C |
| Boiling point | 78-80 °C/4 mmHg (lit.) |
| density | 1.286 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 213 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid After Melting |
| pka | 13.91±0.10(Predicted) |
| color | Clear colorless to light brown |
| Specific Gravity | 1.286 |
| Water Solubility | Soluble in water. |
| BRN | 1450174 |
| InChI | InChI=1S/C8H7F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-4,12H,5H2 |
| InChIKey | MOOUWXDQAUXZRG-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 349-95-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Trifluoromethyl)benzyl alcohol(349-95-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| HazardClass | CORROSIVE |
| HS Code | 29062900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |