
26172-54-3
| Name | 2-Methyl-4-isothiazolin-3-one hydrochloride |
| CAS | 26172-54-3 |
| EINECS(EC#) | 247-499-3 |
| Molecular Formula | C4H6ClNOS |
| MDL Number | MFCD06804636 |
| Molecular Weight | 151.61 |
| MOL File | 26172-54-3.mol |
Chemical Properties
| Melting point | 165-170° |
| density | 1.551 at 21℃ |
| vapor pressure | 0.777-1Pa at 20-25℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 3993054 |
| Stability: | Hygroscopic |
| Major Application | microbiology |
| InChI | InChI=1S/C4H5NOS.ClH/c1-5-4(6)2-3-7-5;/h2-3H,1H3;1H |
| InChIKey | SJXPQSRCFCPWQQ-UHFFFAOYSA-N |
| SMILES | O=C1C=CSN1C.Cl |
| LogP | -0.44 at 20℃ and pH2 |
| Surface tension | 71.3mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 26172-54-3(CAS DataBase Reference) |
| EPA Substance Registry System | 26172-54-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H314-H317-H410 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 8, 6.1 |
| HS Code | 2934100090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1A Skin Sens. 1 |


