
26172-55-4
| Name | 5-Chloro-2-methyl-4-isothiazolin-3-one |
| CAS | 26172-55-4 |
| EINECS(EC#) | 247-500-7 |
| Molecular Formula | C4H4ClNOS |
| MDL Number | MFCD00792550 |
| Molecular Weight | 149.6 |
| MOL File | 26172-55-4.mol |
Chemical Properties
| Appearance | Liquid |
| Melting point | 42-45?C |
| Boiling point | 109.7°C |
| density | 1.25 (14% aq.) |
| refractive index | n |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Liquid |
| pka | -4.06±0.40(Predicted) |
| color | White |
| Odor | Pungent aromatic odor |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Usage | Isocil(R) RW is a high performance industrial microbiocide for use in recirculating water cooling towers, wood, mold and mildew control, pulp and paper mills, air washer systems. Suggested applications: Industrial water treatment. Very low use levels. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| Cosmetic Ingredient Review (CIR) | 5-Chloro-2-methyl-4-isothiazolin-3-one (26172-55-4) |
| InChI | InChI=1S/C4H4ClNOS/c1-6-4(7)2-3(5)8-6/h2H,1H3 |
| Contact allergens | |
| InChIKey | DHNRXBZYEKSXIM-UHFFFAOYSA-N |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H412 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | C,N,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 1 |
| RTECS | NX8156850 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 3808929090 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 26172-55-4(Hazardous Substances Data) |
