2512-29-0
| Name | Fast Yellow G |
| CAS | 2512-29-0 |
| EINECS(EC#) | 219-730-8 |
| Molecular Formula | C17H16N4O4 |
| MDL Number | MFCD00078234 |
| Molecular Weight | 340.33 |
| MOL File | 2512-29-0.mol |
Chemical Properties
| Melting point | >255°C (dec.) |
| Boiling point | 546.5±50.0 °C(Predicted) |
| density | 1.30±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Very Slightly, Heated) |
| Colour Index | 11680 |
| form | neat |
| pka | 8.80±0.59(Predicted) |
| color | Yellow to Dark Yellow |
| Stability: | Light Sensitive |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C17H16N4O4/c1-11-8-9-14(15(10-11)21(24)25)19-20-16(12(2)22)17(23)18-13-6-4-3-5-7-13/h3-10,16H,1-2H3,(H,18,23)/b20-19+ |
| InChIKey | MFYSUUPKMDJYPF-FMQUCBEESA-N |
| SMILES | O=C(C(C(C)=O)/N=N/C1=CC=C(C)C=C1[N+]([O-])=O)NC2=CC=CC=C2 |
| LogP | 3.1 at 22.5℃ and pH6 |
| CAS DataBase Reference | 2512-29-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2512-29-0(EPA Substance) |
Safety Data
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 3204.13.8000 |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 2512-29-0(Hazardous Substances Data) |