2483-57-0
| Name | Methyl nitroacetate |
| CAS | 2483-57-0 |
| EINECS(EC#) | 219-622-0 |
| Molecular Formula | C3H5NO4 |
| MDL Number | MFCD00075480 |
| Molecular Weight | 119.08 |
| MOL File | 2483-57-0.mol |
Chemical Properties
| Appearance | clear yellow liquid |
| Boiling point | 195-198 °C (lit.) |
| density | 1.294 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 221 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Miscible with ethanol, ether and most organic solvents. |
| form | clear liquid |
| pka | 5.73±0.29(Predicted) |
| color | Colorless to Light yellow |
| Sensitive | Light Sensitive |
| BRN | 1758670 |
| InChI | InChI=1S/C3H5NO4/c1-8-3(5)2-4(6)7/h2H2,1H3 |
| InChIKey | ALBSWLMUHHZLLR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C[N+]([O-])=O |
| CAS DataBase Reference | 2483-57-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, nitro-, methyl ester(2483-57-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | AJ1093000 |
| F | 8 |
| HS Code | 29161995 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |