2304-30-5
| Name | Tetrabutylphosphonium chloride |
| CAS | 2304-30-5 |
| EINECS(EC#) | 218-964-8 |
| Molecular Formula | C16H36ClP |
| MDL Number | MFCD00011854 |
| Molecular Weight | 294.88 |
| MOL File | 2304-30-5.mol |
Chemical Properties
| Melting point | 62-66 °C (dec.) (lit.) |
| Boiling point | 344.8℃[at 101 325 Pa] |
| density | 0.978[at 20℃] |
| vapor pressure | 0.018Pa at 25℃ |
| refractive index | 1.5 |
| Fp | 4°C (39°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| color | colorless to pale-yellow |
| Specific Gravity | 0.91 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4019186 |
| Stability: | Hygroscopic |
| InChI | 1S/C16H36P.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IBWGNZVCJVLSHB-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[P+](CCCC)(CCCC)CCCC |
| LogP | -0.44 at 23℃ |
| CAS DataBase Reference | 2304-30-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H310+H330-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TA2419000 |
| F | 3-10 |
| TSCA | No |
| HS Code | 2931.90.9051 |
| REACH Registrations | Active |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1B |