
22282-99-1
| Name | 4-Bromo-2-methylpyridine |
| CAS | 22282-99-1 |
| EINECS(EC#) | 624-896-3 |
| Molecular Formula | C6H6BrN |
| MDL Number | MFCD03788196 |
| Molecular Weight | 172.02 |
| MOL File | 22282-99-1.mol |
Chemical Properties
| Appearance | Light yellow liquid |
| Melting point | 26-27° |
| Boiling point | 76 °C / 14mmHg |
| density | 1.450 g/mL at 25 °C |
| refractive index | n |
| Fp | 174 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Dichloromethane |
| form | Pale Yellow Liquid |
| pka | 4.38±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Miscible with dichloromethane. Immiscible with water. |
| InChI | InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| InChIKey | JFBMFWHEXBLFCR-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 22282-99-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

