22280-56-4
| Name | 2-Chloro-3-methyl-5-nitropyridine |
| CAS | 22280-56-4 |
| EINECS(EC#) | 244-889-5 |
| Molecular Formula | C6H5ClN2O2 |
| MDL Number | MFCD00173686 |
| Molecular Weight | 172.57 |
| MOL File | 22280-56-4.mol |
Chemical Properties
| Appearance | Light beige to cream colored crystalline powder |
| Melting point | 45-50 °C |
| Boiling point | 145 °C / 18mmHg |
| density | 1.5610 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Fp | >110°C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | -3.61±0.10(Predicted) |
| color | Light beige to cream |
| Sensitive | Hygroscopic |
| Detection Methods | GC |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| InChIKey | OSIOIGXJUZTWRI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 22280-56-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
