20103-09-7
| Name | 2,5-Dichlorobenzene-1,4-diamine |
| CAS | 20103-09-7 |
| EINECS(EC#) | 243-512-1 |
| Molecular Formula | C6H6Cl2N2 |
| MDL Number | MFCD00007902 |
| Molecular Weight | 177.03 |
| MOL File | 20103-09-7.mol |
Chemical Properties
| Appearance | light brown to pinkish-grey powder |
| Melting point | 164-166 °C (dec.)(lit.) |
| Boiling point | 291.88°C (rough estimate) |
| density | 1.4668 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 3.16±0.10(Predicted) |
| color | White to Brown |
| BRN | 2803055 |
| InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H,9-10H2 |
| InChIKey | QAYVHDDEMLNVMO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(N)C=C1Cl |
| CAS DataBase Reference | 20103-09-7(CAS DataBase Reference) |
| EPA Substance Registry System | 20103-09-7(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SS9150000 |
| F | 9 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 20103-09-7(Hazardous Substances Data) |
