5348-42-5
| Name | 4,5-Dichloro-1,2-benzenediamine |
| CAS | 5348-42-5 |
| EINECS(EC#) | 226-305-0 |
| Molecular Formula | C6H6Cl2N2 |
| MDL Number | MFCD00007723 |
| Molecular Weight | 177.03 |
| MOL File | 5348-42-5.mol |
Chemical Properties
| Appearance | red-brown to brown crystalline powder |
| Melting point | 158-164 °C(lit.) |
| Boiling point | 291.88°C (rough estimate) |
| density | 1.4668 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Crystalline Powder |
| pka | 2.77±0.10(Predicted) |
| color | Red-brown to brown |
| Water Solubility | Soluble in methanol and Dimethyl sulfoxide. Insoluble in water. |
| BRN | 1072811 |
| InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2 |
| InChIKey | IWFHBRFJOHTIPU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(Cl)C=C1N |
| CAS DataBase Reference | 5348-42-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,5-Dichloro-ortho-phenylenediamine(5348-42-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |