
51-36-5
| Name | 3,5-Dichlorobenzoic acid |
| CAS | 51-36-5 |
| EINECS(EC#) | 200-092-4 |
| Molecular Formula | C7H4Cl2O2 |
| MDL Number | MFCD00002494 |
| Molecular Weight | 191.01 |
| MOL File | 51-36-5.mol |
Chemical Properties
| Appearance | White to beige powder |
| Melting point | 184-187 °C (lit.) |
| Boiling point | 273.68°C (rough estimate) |
| density | 1.4410 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 3.46±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 147.1mg/L(temperature not stated) |
| BRN | 2044776 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | CXKCZFDUOYMOOP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 51-36-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichlorobenzoic acid(51-36-5) |
| EPA Substance Registry System | 51-36-5(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DG7350000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
