
36062-19-8
| Name | 1,3-Diaminoguanidine monohydrochloride |
| CAS | 36062-19-8 |
| EINECS(EC#) | 252-854-0 |
| Molecular Formula | CH8ClN5 |
| MDL Number | MFCD00012948 |
| Molecular Weight | 125.56 |
| MOL File | 36062-19-8.mol |
Chemical Properties
| Appearance | white to light beige granular powder |
| Melting point | 180-182 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear to very slightly hazy, colorless to faintly yellow |
| form | Granular Powder |
| color | White to light beige |
| Water Solubility | very faint turbidity |
| Sensitive | Hygroscopic |
| BRN | 3556702 |
| InChI | InChI=1S/CH7N5.ClH/c2-1(5-3)6-4;/h3-4H2,(H3,2,5,6);1H |
| InChIKey | HAZRIBSLCUYMQP-UHFFFAOYSA-N |
| SMILES | C(=N)(NN)NN.Cl |
| CAS DataBase Reference | 36062-19-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HS Code | 29212900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
