| Appearance |
red-brown powder |
| Melting point |
>250°C |
| bulk density |
650kg/m3 |
| density |
0.871[at 20℃] |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Store at RT. |
| solubility |
100g/l |
| Colour Index |
45410 |
| form |
Powder/Solid |
| color |
Red Brown |
| PH |
9.7 (1g/l, H2O, 20℃) |
| PH Range |
NonQ uorescence (2.5) to yellowish-blue Q uorescence (4.0) |
| Stability: |
Stable. Incompatible with strong oxidizing agents. |
| Water Solubility |
water: 1mg/mL, clear, red |
| λmax |
548nm, 510nm |
| BRN |
3887100 |
| Biological Applications |
Detecting proteins; treating microbial infection,parasitic infection,skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory system,head,neck,endocrine system |
| Major Application |
Optical waveguides, color filter, lithographic printing plates, display device, visualization of dentaldevice, inks, highlighters, textiles, hair dyes, cosmetics, visualization of dentalplaque, treatment of infectitious diseases, antitumor agents |
| Cosmetics Ingredients Functions |
COLORANT
HAIR DYEING |
| InChI |
1S/C20H4Br4Cl4O5.2Na/c21-5-1-3-17(9(23)15(5)29)32-18-4(2-6(22)16(30)10(18)24)20(3)8-7(19(31)33-20)11(25)13(27)14(28)12(8)26;;/h1-2,29-30H;;/q;2*+1/p-2 |
| InChIKey |
OOYIOIOOWUGAHD-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].[O-]c1c(Br)cc2c(Oc3c(Br)c([O-])c(Br)cc3C24OC(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c45)c1Br |
| LogP |
0.165 at 25℃ |
| CAS DataBase Reference |
18472-87-2(CAS DataBase Reference) |
| EPA Substance Registry System |
18472-87-2(EPA Substance) |
