3087-16-9
| Name | Acid Green 50 |
| CAS | 3087-16-9 |
| EINECS(EC#) | 221-409-2 |
| Molecular Formula | C27H25N2NaO7S2 |
| MDL Number | MFCD00012117 |
| Molecular Weight | 576.62 |
| MOL File | 3087-16-9.mol |
Chemical Properties
| Appearance | solid |
| Melting point | >300°C |
| density | 0.541[at 20℃] |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Colour Index | 44090 |
| form | Powder |
| color | Dark brown or black |
| Stability: | Incompatible with strong oxidizing agents. |
| Water Solubility | 492.554g/L at 28℃ |
| ε(extinction coefficient) | ≥10000 at 300-306nm in water at 0.005g/L ≥50000 at 236-242nm in water at 0.005g/L ≥60000 at 630-636nm in water at 0.005g/L |
| λmax | 633 nm |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChIKey | BVUWAHIFBKMCJZ-UHFFFAOYSA-N |
| SMILES | C(=C1C=C/C(=[N+](/C)\C)/C=C1)(C1C=CC(N(C)C)=CC=1)C1=C(C(S([O-])(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=C12)O.[NaH] |
| LogP | 0.595 at 25℃ |
| CAS DataBase Reference | 3087-16-9(CAS DataBase Reference) |
| EPA Substance Registry System | 3087-16-9(EPA Substance) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BQ1150000 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |