
162101-25-9
| Name | 2,6-Difluorophenylboronic acid |
| CAS | 162101-25-9 |
| EINECS(EC#) | 627-874-1 |
| Molecular Formula | C6H5BF2O2 |
| MDL Number | MFCD01318987 |
| Molecular Weight | 157.91 |
| MOL File | 162101-25-9.mol |
Chemical Properties
| Appearance | White to off-white crystalline powder |
| Melting point | 147-149 °C (lit.) |
| Boiling point | 260.1±50.0 °C(Predicted) |
| density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | Soluble in methanol. |
| form | solid |
| pka | 8.12±0.58(Predicted) |
| color | White to Almost white |
| Usage | Intermediates of Liquid Crystals |
| BRN | 8545931 |
| InChI | InChI=1S/C6H5BF2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,10-11H |
| InChIKey | DBZAICSEFBVFHL-UHFFFAOYSA-N |
| SMILES | B(C1=C(F)C=CC=C1F)(O)O |
| CAS DataBase Reference | 162101-25-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
