
1530-32-1
| Name | Ethyltriphenylphosphonium bromide |
| CAS | 1530-32-1 |
| EINECS(EC#) | 216-223-3 |
| Molecular Formula | C20H20BrP |
| MDL Number | MFCD00011838 |
| Molecular Weight | 371.25 |
| MOL File | 1530-32-1.mol |
Chemical Properties
| Appearance | White to off-white crystalline powder |
| Melting point | 203-205 °C(lit.) |
| Boiling point | 240℃[at 101 325 Pa] |
| density | 1.38[at 20℃] |
| vapor pressure | 0-0.1Pa at 20-25℃ |
| Fp | 200 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 174g/l soluble |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | 120 g/L (23 ºC) |
| Sensitive | Hygroscopic |
| BRN | 3599630 |
| InChI | 1S/C20H20P.BrH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | JHYNXXDQQHTCHJ-UHFFFAOYSA-M |
| SMILES | [Br-].CC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| LogP | -0.69--0.446 at 35℃ |
| CAS DataBase Reference | 1530-32-1(CAS DataBase Reference) |
| Storage Precautions | Moisture sensitive |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318-H412 |
| Precautionary statements | P264-P270-P273-P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 |

