14243-64-2
| Name | Chloro(triphenylphosphine)gold |
| CAS | 14243-64-2 |
| EINECS(EC#) | 238-117-6 |
| Molecular Formula | C18H15AuClP |
| MDL Number | MFCD00009588 |
| Molecular Weight | 494.71 |
| MOL File | 14243-64-2.mol |
Chemical Properties
| Appearance | White crystalline powder |
| Melting point | 248-249°C |
| storage temp. | Store under Nitrogen |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in methylene chloride, acetonitrile, benzene and acetone. Insoluble in water and ethanol. |
| InChI | InChI=1S/C18H15P.Au.ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1 |
| InChIKey | IFPWCRBNZXUWGC-UHFFFAOYSA-M |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.Cl[Au] |
| CAS DataBase Reference | 14243-64-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3464 |
| WGK Germany | 3 |
| HS Code | 71159010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |