14233-37-5
| Name | Solvent Blue 36 |
| CAS | 14233-37-5 |
| EINECS(EC#) | 238-101-9 |
| Molecular Formula | C20H22N2O2 |
| MDL Number | MFCD00045353 |
| Molecular Weight | 322.4 |
| MOL File | 14233-37-5.mol |
Chemical Properties
| Melting point | 176-178 °C |
| Boiling point | 540.6±50.0 °C(Predicted) |
| density | 1.165 g/cm3 |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Sealed in dry,2-8°C |
| solubility | toluene: 0.01g/10 mL, blue to very deep blue |
| form | Solid:particulate/powder |
| pka | 6.13±0.20(Predicted) |
| Appearance | Purple to black Solid |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C20H22N2O2/c1-11(2)21-15-9-10-16(22-12(3)4)18-17(15)19(23)13-7-5-6-8-14(13)20(18)24/h5-12,21-22H,1-4H3 |
| InChIKey | BLFZMXOCPASACY-UHFFFAOYSA-N |
| SMILES | C1(NC(C)C)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(NC(C)C)C=C1 |
| LogP | 5.2 at 25℃ and pH6 |
| CAS DataBase Reference | 14233-37-5(CAS DataBase Reference) |
| EPA Substance Registry System | 14233-37-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |