
15086-94-9
| Name | Solvent Red 43 |
| CAS | 15086-94-9 |
| EINECS(EC#) | 241-409-6 |
| Molecular Formula | C20H8Br4O5 |
| MDL Number | MFCD00005040 |
| Molecular Weight | 647.89 |
| MOL File | 15086-94-9.mol |
Chemical Properties
| Appearance | orange-brown powder |
| Melting point | 300 °C |
| Boiling point | 640.3±55.0 °C(Predicted) |
| density | 1.02 g/mL at 20 °C |
| refractive index | 1.5000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, dark red |
| Colour Index | 45380:2 |
| form | Liquid |
| pka | 6.97±0.20(Predicted) |
| color | White to Light yellow to Red |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| λmax | 524 nm |
| Henry's Law Constant | 4.4×1012 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C20H8Br4O5/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20/h1-6,25-26H |
| InChIKey | DBZJJPROPLPMSN-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc2c(Oc3c(Br)c(O)c(Br)cc3C24OC(=O)c5ccccc45)c1Br |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1170 3/PG 2 |
| WGK Germany | 3 |
| RTECS | LM5850000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 32041919 |
| Storage Class | 11 - Combustible Solids |
