
140-87-4
| Name | Cyanoacetohydrazide |
| CAS | 140-87-4 |
| EINECS(EC#) | 205-437-2 |
| Molecular Formula | C3H5N3O |
| MDL Number | MFCD00007611 |
| Molecular Weight | 99.09 |
| MOL File | 140-87-4.mol |
Chemical Properties
| Appearance | BROWN GRANULAR CRYSTALLINE POWDER |
| Melting point | 108-110 °C (lit.) |
| Boiling point | 185.55°C (rough estimate) |
| density | 1.3131 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO : 150 mg/mL (1513.78 mM) |
| form | powder to crystal |
| pka | pK1:2.34(+2);pK2:11.17(+1) (25°C) |
| color | White to Light yellow to Light orange |
| Water Solubility | almost transparency |
| Merck | 14,2680 |
| BRN | 1751498 |
| InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5/h1,5H2,(H,6,7) |
| InChIKey | HPHBOJANXDKUQD-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)CC#N |
| CAS DataBase Reference | 140-87-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha-cyanoacetic acid, hydrazide(140-87-4) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AG4200000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29280090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 140-87-4(Hazardous Substances Data) |
| Toxicity |
