
130-14-3
| Name | Sodium 1-naphthalenesulfonate |
| CAS | 130-14-3 |
| EINECS(EC#) | 204-976-0 |
| Molecular Formula | C10H7NaO3S |
| MDL Number | MFCD00064964 |
| Molecular Weight | 230.22 |
| MOL File | 130-14-3.mol |
Chemical Properties
| Appearance | Deliquescent crystals.Soluble in water, alcohol, and ether. Combustible. |
| Melting point | 299-301°C |
| density | 0.516[at 20℃] |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3639038 |
| InChI | InChI=1S/C10H8O3S.Na/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | HIEHAIZHJZLEPQ-UHFFFAOYSA-M |
| SMILES | C12C=CC=CC1=CC=CC=2S([O-])(=O)=O.[Na+] |
| LogP | -1.776 at 25℃ |
| Uses | |
| CAS DataBase Reference | 130-14-3(CAS DataBase Reference) |
| EPA Substance Registry System | 130-14-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 2904100090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
