
128071-75-0
| Name | 2-BROMO-3-FORMYLPYRIDINE |
| CAS | 128071-75-0 |
| Molecular Formula | C6H4BrNO |
| MDL Number | MFCD04966945 |
| Molecular Weight | 186.01 |
| MOL File | 128071-75-0.mol |
Chemical Properties
| Melting point | 73 °C |
| Boiling point | 100 °C / 3mmHg |
| density | 1.683±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -1.01±0.10(Predicted) |
| color | White to Orange to Green |
| Detection Methods | HPLC |
| InChI | InChI=1S/C6H4BrNO/c7-6-5(4-9)2-1-3-8-6/h1-4H |
| InChIKey | GNFWMEFWZWXLIN-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1C=O |
| CAS DataBase Reference | 128071-75-0(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
