119313-12-1
| Name | 2-Benzyl-2-(dimethylamino)-4'-morpholinobutyrophenone |
| CAS | 119313-12-1 |
| EINECS(EC#) | 404-360-3 |
| Molecular Formula | C23H30N2O2 |
| MDL Number | MFCD00191775 |
| Molecular Weight | 366.5 |
| MOL File | 119313-12-1.mol |
Chemical Properties
| Melting point | 116-119 °C (lit.) |
| Boiling point | 528.8±50.0 °C(Predicted) |
| density | 1.094±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0.01Pa at 25-95℃ |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 3240 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| pka | 7.04±0.50(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | 5.9mg/L at 20℃ |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C23H30N2O2/c1-4-23(24(2)3,18-19-8-6-5-7-9-19)22(26)20-10-12-21(13-11-20)25-14-16-27-17-15-25/h5-13H,4,14-18H2,1-3H3 |
| InChIKey | UHFFVFAKEGKNAQ-UHFFFAOYSA-N |
| SMILES | CCC(Cc1ccccc1)(N(C)C)C(=O)c2ccc(cc2)N3CCOCC3 |
| LogP | 2.91 at 25℃ |
| CAS DataBase Reference | 119313-12-1(CAS DataBase Reference) |
| EPA Substance Registry System | 119313-12-1(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360D-H410 |
| Precautionary statements | P201-P202-P273-P280-P308+P313-P391 |
| Hazard Codes | N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | EL7755000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
