
116230-30-9
| Name | 2-Bromo-7-hydroxynaphthalene |
| CAS | 116230-30-9 |
| EINECS(EC#) | 628-835-1 |
| Molecular Formula | C10H7BrO |
| MDL Number | MFCD00277644 |
| Molecular Weight | 223.07 |
| MOL File | 116230-30-9.mol |
Chemical Properties
| Melting point | 133-138 °C |
| Boiling point | 353.8±15.0 °C(Predicted) |
| density | 1.614±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 9.17±0.40(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C10H7BrO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6,12H |
| InChIKey | VWSBGGRCEQOTNU-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC(Br)=C2)=CC=C1O |
| CAS DataBase Reference | 116230-30-9 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

