573-97-7
| Name | 1-Bromo-2-naphthol |
| CAS | 573-97-7 |
| EINECS(EC#) | 209-363-1 |
| Molecular Formula | C10H7BrO |
| MDL Number | MFCD00003869 |
| Molecular Weight | 223.07 |
| MOL File | 573-97-7.mol |
Chemical Properties
| Appearance | off-white to beige or brown-purple cryst. powder |
| Melting point | 78-81 °C (lit.) |
| Boiling point | 130°C |
| density | 1.4412 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 7.28±0.50(Predicted) |
| color | Off-white to beige or brown-purple |
| Detection Methods | GC,NMR |
| BRN | 2044001 |
| InChI | InChI=1S/C10H7BrO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1O |
| CAS DataBase Reference | 573-97-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QL3361000 |
| HazardClass | IRRITANT |
| HS Code | 29081000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |