15231-91-1
| Name | 6-Bromo-2-naphthol |
| CAS | 15231-91-1 |
| EINECS(EC#) | 239-279-0 |
| Molecular Formula | C10H7BrO |
| MDL Number | MFCD00004081 |
| Molecular Weight | 223.07 |
| MOL File | 15231-91-1.mol |
Chemical Properties
| Appearance | off-white to beige powder |
| Melting point | 122-124 °C (lit.) |
| Boiling point | 130°C (rough estimate) |
| density | 1.4412 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Store at RT. |
| solubility | Chloroform, Methanol |
| form | Powder |
| pka | 9.26±0.40(Predicted) |
| color | Off-white to beige |
| BRN | 1100270 |
| InChI | InChI=1S/C10H7BrO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6,12H |
| InChIKey | YLDFTMJPQJXGSS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1O |
| CAS DataBase Reference | 15231-91-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthalenol, 6-bromo-(15231-91-1) |
| EPA Substance Registry System | 15231-91-1(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QL3365000 |
| Hazard Note | Irritant |
| HS Code | 29037990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |