
109431-87-0
| Name | (R)-(-)-N-Boc-3-pyrrolidinol |
| CAS | 109431-87-0 |
| Molecular Formula | C9H17NO3 |
| MDL Number | MFCD01317838 |
| Molecular Weight | 187.24 |
| MOL File | 109431-87-0.mol |
Chemical Properties
| Appearance | White to off-white powder |
| Melting point | 62-65 °C(lit.) |
| alpha | -7 º (c=1, MeOH) |
| Boiling point | 273.3±33.0 °C(Predicted) |
| density | 1.142±0.06 g/cm3(Predicted) |
| refractive index | -27 ° (C=1, MeOH) |
| storage temp. | Store at 0-5°C |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 14.74±0.20(Predicted) |
| color | White to off-white |
| Optical Rotation | [α]20/D 26±1, c = 1 in methanol |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | APCBTRDHCDOPNY-SSDOTTSWSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](O)C1 |
| CAS DataBase Reference | 109431-87-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

