103057-44-9
| Name | (R)-1-Boc-3-hydroxypyrrolidine |
| CAS | 103057-44-9 |
| EINECS(EC#) | 600-388-7 |
| Molecular Formula | C9H17NO3 |
| MDL Number | MFCD04038535 |
| Molecular Weight | 187.24 |
| MOL File | 103057-44-9.mol |
Chemical Properties
| Melting point | 62.1-62.2°C |
| Boiling point | 273.3±33.0 °C(Predicted) |
| density | 1.142±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.74±0.20(Predicted) |
| color | White to Almost white |
| Optical Rotation | Consistent with structure |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3 |
| InChIKey | APCBTRDHCDOPNY-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(O)C1 |
| CAS DataBase Reference | 103057-44-9(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
