
101066-61-9
| Name | 2-Chloroisonicotinaldehyde |
| CAS | 101066-61-9 |
| Molecular Formula | C6H4ClNO |
| MDL Number | MFCD01315308 |
| Molecular Weight | 141.56 |
| MOL File | 101066-61-9.mol |
Chemical Properties
| Appearance | white to yellow solid |
| Melting point | 46-50 °C |
| Boiling point | 243.4±20.0 °C(Predicted) |
| density | 1.332±0.06 g/cm3(Predicted) |
| Fp | >230 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -1.23±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Air Sensitive |
| BRN | 7986625 |
| InChI | InChI=1S/C6H4ClNO/c7-6-3-5(4-9)1-2-8-6/h1-4H |
| InChIKey | UFPOSTQMFOYHJI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C=O)=C1 |
| CAS DataBase Reference | 101066-61-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
